C19H26N2O4 — CID 129433897
(1S,2R,3S,6R,7R)-2-hydroxy-N-[[3-(2-methoxyethoxy)phenyl]methyl]-4-azatricyclo[4.2.1.03,7]nonane-4-carboxamide (PubChem CID 129433897) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (1S,2R,3S,6R,7R)-2-hydroxy-N-[[3-(2-methoxyethoxy)phenyl]methyl]-4-azatricyclo[4.2.1.03,7]nonane-4-carboxamide.
| Compound Name | (1S,2R,3S,6R,7R)-2-hydroxy-N-[[3-(2-methoxyethoxy)phenyl]methyl]-4-azatricyclo[4.2.1.03,7]nonane-4-carboxamide |
|---|---|
| PubChem CID | 129433897 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (1S,2R,3S,6R,7R)-2-hydroxy-N-[[3-(2-methoxyethoxy)phenyl]methyl]-4-azatricyclo[4.2.1.03,7]nonane-4-carboxamide |
| SMILES | COCCOc1cccc(CNC(=O)N2C[C@@H]3C[C@H]4C[C@H]3[C@H]2[C@@H]4O)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-24-5-6-25-15-4-2-3-12(7-15)10-20-19(23)21-11-14-8-13-9-16(14)17(21)18(13)22/h2-4,7,13-14,16-18,22H,5-6,8-11H2,1H3,(H,20,23)/t13-,14-,16+,17-,18+/m0/s1 |
| InChIKey | UZSLTRNWNDIIEE-VGAPYMQISA-N |
| XLogP | 1.62 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|