C16H25N5O2 — CID 129436989
2-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-1-[(1S,2R)-2-methylcyclopropyl]-3-[[(2R)-oxolan-2-yl]methyl]guanidine (PubChem CID 129436989) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-1-[(1S,2R)-2-methylcyclopropyl]-3-[[(2R)-oxolan-2-yl]methyl]guanidine.
| Compound Name | 2-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-1-[(1S,2R)-2-methylcyclopropyl]-3-[[(2R)-oxolan-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 129436989 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-1-[(1S,2R)-2-methylcyclopropyl]-3-[[(2R)-oxolan-2-yl]methyl]guanidine |
| SMILES | C[C@@H]1C[C@@H]1N/C(=N/Cc1nc(C2CC2)no1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H25N5O2/c1-10-7-13(10)19-16(17-8-12-3-2-6-22-12)18-9-14-20-15(21-23-14)11-4-5-11/h10-13H,2-9H2,1H3,(H2,17,18,19)/t10-,12-,13+/m1/s1 |
| InChIKey | VCTHBXWZHSNWEW-RTXFEEFZSA-N |
| XLogP | 1.57 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|