C10H15NO2 — CID 129437844
(1S,2S,3S,5S,7S)-4-hydroxyiminoadamantan-2-ol (PubChem CID 129437844) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (1S,2S,3S,5S,7S)-4-hydroxyiminoadamantan-2-ol.
| Compound Name | (1S,2S,3S,5S,7S)-4-hydroxyiminoadamantan-2-ol |
|---|---|
| PubChem CID | 129437844 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (1S,2S,3S,5S,7S)-4-hydroxyiminoadamantan-2-ol |
| SMILES | ON=C1[C@H]2C[C@H]3C[C@@H](C2)[C@H](O)[C@H]1C3 |
| InChI | InChI=1S/C10H15NO2/c12-10-7-2-5-1-6(4-7)9(11-13)8(10)3-5/h5-8,10,12-13H,1-4H2/t5-,6-,7-,8-,10-/m0/s1 |
| InChIKey | BXKSYBSFYXAENA-RPLNLOMXSA-N |
| XLogP | 1.24 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|