C22H36N2O — CID 172972036
tricyclo[4.3.1.13,8]undecan-4-amine;(NZ)-N-(4-tricyclo[4.3.1.13,8]undecanylidene)hydroxylamine (PubChem CID 172972036) has the molecular formula C22H36N2O and a molecular weight of 344.54 g/mol. Its IUPAC name is tricyclo[4.3.1.13,8]undecan-4-amine;(NZ)-N-(4-tricyclo[4.3.1.13,8]undecanylidene)hydroxylamine.
| Compound Name | tricyclo[4.3.1.13,8]undecan-4-amine;(NZ)-N-(4-tricyclo[4.3.1.13,8]undecanylidene)hydroxylamine |
|---|---|
| PubChem CID | 172972036 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | tricyclo[4.3.1.13,8]undecan-4-amine;(NZ)-N-(4-tricyclo[4.3.1.13,8]undecanylidene)hydroxylamine |
| SMILES | NC1CC2CC3CC(C2)CC1C3.O/N=C1/CC2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C11H17NO.C11H19N/c13-12-11-6-9-2-7-1-8(3-9)5-10(11)4-7;12-11-6-9-2-7-1-8(3-9)5-10(11)4-7/h7-10,13H,1-6H2;7-11H,1-6,12H2/b12-11-; |
| InChIKey | OQXYWAOBWFYROY-AFEZEDKISA-N |
| XLogP | 4.82 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|