C26H32N2O2 — CID 129438349
(1'S,2R,3aR,5'S)-5-(4-methoxyphenyl)-6',6'-dimethyl-3a-phenylspiro[4,6-dihydro-3H-imidazo[1,5-b][1,2]oxazole-2,2'-bicyclo[3.1.1]heptane] (PubChem CID 129438349) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is (1'S,2R,3aR,5'S)-5-(4-methoxyphenyl)-6',6'-dimethyl-3a-phenylspiro[4,6-dihydro-3H-imidazo[1,5-b][1,2]oxazole-2,2'-bicyclo[3.1.1]heptane].
| Compound Name | (1'S,2R,3aR,5'S)-5-(4-methoxyphenyl)-6',6'-dimethyl-3a-phenylspiro[4,6-dihydro-3H-imidazo[1,5-b][1,2]oxazole-2,2'-bicyclo[3.1.1]heptane] |
|---|---|
| PubChem CID | 129438349 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | (1'S,2R,3aR,5'S)-5-(4-methoxyphenyl)-6',6'-dimethyl-3a-phenylspiro[4,6-dihydro-3H-imidazo[1,5-b][1,2]oxazole-2,2'-bicyclo[3.1.1]heptane] |
| SMILES | COc1ccc(N2CN3O[C@]4(CC[C@H]5C[C@H]4C5(C)C)C[C@@]3(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H32N2O2/c1-24(2)20-13-14-26(23(24)15-20)16-25(19-7-5-4-6-8-19)17-27(18-28(25)30-26)21-9-11-22(29-3)12-10-21/h4-12,20,23H,13-18H2,1-3H3/t20-,23-,25-,26+/m0/s1 |
| InChIKey | FWQQIYGKLDDDBV-IDCRYQTOSA-N |
| XLogP | 5.20 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|