C24H30N6 — CID 129439585
N-[[(2S,3R,8aR)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 129439585) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is N-[[(2S,3R,8aR)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[[(2S,3R,8aR)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 129439585 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | N-[[(2S,3R,8aR)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | C[C@@H]1CC2=CCCC(C)(C)[C@H]2C[C@@H]1C=NNc1nnc2c3ccccc3n(C)c2n1 |
| InChI | InChI=1S/C24H30N6/c1-15-12-16-8-7-11-24(2,3)19(16)13-17(15)14-25-28-23-26-22-21(27-29-23)18-9-5-6-10-20(18)30(22)4/h5-6,8-10,14-15,17,19H,7,11-13H2,1-4H3,(H,26,28,29)/t15-,17-,19+/m1/s1 |
| InChIKey | NDSONPMOFYKBTC-SUMDDJOVSA-N |
| XLogP | 5.32 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|