C33H34F2N2O3 — CID 129440184
(8R,9R,13R,14R)-17-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 129440184) has the molecular formula C33H34F2N2O3 and a molecular weight of 544.64 g/mol. Its IUPAC name is (8R,9R,13R,14R)-17-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9R,13R,14R)-17-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 129440184 |
| Molecular Formula | C33H34F2N2O3 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | (8R,9R,13R,14R)-17-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | COc1ccc(C=NN=C2CC[C@@H]3[C@@H]4CCc5cc(O)ccc5[C@@H]4CC[C@@]23C)cc1COc1ccc(F)cc1F |
| InChI | InChI=1S/C33H34F2N2O3/c1-33-14-13-26-25-8-6-24(38)16-21(25)4-7-27(26)28(33)9-12-32(33)37-36-18-20-3-10-30(39-2)22(15-20)19-40-31-11-5-23(34)17-29(31)35/h3,5-6,8,10-11,15-18,26-28,38H,4,7,9,12-14,19H2,1-2H3/t26-,27+,28+,33+/m0/s1 |
| InChIKey | RBVUIWVCLSYSBF-AMBSETBHSA-N |
| XLogP | 7.59 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|