C28H40N2O6 — CID 129448293
ethyl (1S,2R,4R,8S,9R,12R,13R,16S)-16-acetyloxy-8-(N-methoxy-C-methylcarbonimidoyl)-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,18-diene-5-carboxylate (PubChem CID 129448293) has the molecular formula C28H40N2O6 and a molecular weight of 500.64 g/mol. Its IUPAC name is ethyl (1S,2R,4R,8S,9R,12R,13R,16S)-16-acetyloxy-8-(N-methoxy-C-methylcarbonimidoyl)-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,18-diene-5-carboxylate.
| Compound Name | ethyl (1S,2R,4R,8S,9R,12R,13R,16S)-16-acetyloxy-8-(N-methoxy-C-methylcarbonimidoyl)-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,18-diene-5-carboxylate |
|---|---|
| PubChem CID | 129448293 |
| Molecular Formula | C28H40N2O6 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | ethyl (1S,2R,4R,8S,9R,12R,13R,16S)-16-acetyloxy-8-(N-methoxy-C-methylcarbonimidoyl)-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-5,18-diene-5-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@@]2(C(C)=NOC)[C@@H]1C[C@@H]1[C@H]3CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C28H40N2O6/c1-7-34-25(32)24-23-15-22-20-9-8-18-14-19(35-17(3)31)10-12-26(18,4)21(20)11-13-27(22,5)28(23,36-30-24)16(2)29-33-6/h8,19-23H,7,9-15H2,1-6H3/t19-,20-,21+,22+,23+,26-,27+,28-/m0/s1 |
| InChIKey | UMRHNFCWSRDOLX-XCZMPZEPSA-N |
| XLogP | 4.82 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|