C27H25N5O5 — CID 129449543
N-[(1S)-2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 129449543) has the molecular formula C27H25N5O5 and a molecular weight of 499.53 g/mol. Its IUPAC name is N-[(1S)-2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[(1S)-2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 129449543 |
| Molecular Formula | C27H25N5O5 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[(1S)-2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | COc1ccc(C(C)=NNC(=O)[C@@H](NC(=O)c2ccccc2)c2n[nH]c(=O)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C27H25N5O5/c1-16(19-14-13-18(36-2)15-22(19)37-3)29-32-27(35)24(28-25(33)17-9-5-4-6-10-17)23-20-11-7-8-12-21(20)26(34)31-30-23/h4-15,24H,1-3H3,(H,28,33)(H,31,34)(H,32,35)/t24-/m0/s1 |
| InChIKey | IWEFKFOZCPEQFN-DEOSSOPVSA-N |
| XLogP | 2.95 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|