C26H20F3N5O3 — CID 87771313
N-[2-oxo-1-(4-oxo-3H-phthalazin-1-yl)-2-[(2E)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]ethyl]benzamide (PubChem CID 87771313) has the molecular formula C26H20F3N5O3 and a molecular weight of 507.47 g/mol. Its IUPAC name is N-[2-oxo-1-(4-oxo-3H-phthalazin-1-yl)-2-[(2E)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | N-[2-oxo-1-(4-oxo-3H-phthalazin-1-yl)-2-[(2E)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 87771313 |
| Molecular Formula | C26H20F3N5O3 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | N-[2-oxo-1-(4-oxo-3H-phthalazin-1-yl)-2-[(2E)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]ethyl]benzamide |
| SMILES | C/C(=N\NC(=O)C(NC(=O)c1ccccc1)c1n[nH]c(=O)c2ccccc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H20F3N5O3/c1-15(17-10-7-11-18(14-17)26(27,28)29)31-34-25(37)22(30-23(35)16-8-3-2-4-9-16)21-19-12-5-6-13-20(19)24(36)33-32-21/h2-14,22H,1H3,(H,30,35)(H,33,36)(H,34,37)/b31-15+ |
| InChIKey | PLTWZTGNYPBFEO-IBBHUPRXSA-N |
| XLogP | 3.95 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|