C23H21N5O5 — CID 98457637
N-[(1S)-2-oxo-2-[(2Z)-2-[1-[(3S)-2-oxooxolan-3-yl]ethylidene]hydrazinyl]-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 98457637) has the molecular formula C23H21N5O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is N-[(1S)-2-oxo-2-[(2Z)-2-[1-[(3S)-2-oxooxolan-3-yl]ethylidene]hydrazinyl]-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[(1S)-2-oxo-2-[(2Z)-2-[1-[(3S)-2-oxooxolan-3-yl]ethylidene]hydrazinyl]-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 98457637 |
| Molecular Formula | C23H21N5O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[(1S)-2-oxo-2-[(2Z)-2-[1-[(3S)-2-oxooxolan-3-yl]ethylidene]hydrazinyl]-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | C/C(=N/NC(=O)[C@@H](NC(=O)c1ccccc1)c1n[nH]c(=O)c2ccccc12)[C@@H]1CCOC1=O |
| InChI | InChI=1S/C23H21N5O5/c1-13(15-11-12-33-23(15)32)25-28-22(31)19(24-20(29)14-7-3-2-4-8-14)18-16-9-5-6-10-17(16)21(30)27-26-18/h2-10,15,19H,11-12H2,1H3,(H,24,29)(H,27,30)(H,28,31)/b25-13-/t15-,19-/m0/s1 |
| InChIKey | DQKUQUUEIRZCCW-JVNYRXBYSA-N |
| XLogP | 1.45 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|