C25H20N6O5 — CID 2831900
N-[2-[2-[1-(4-nitrophenyl)ethylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 2831900) has the molecular formula C25H20N6O5 and a molecular weight of 484.47 g/mol. Its IUPAC name is N-[2-[2-[1-(4-nitrophenyl)ethylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[2-[2-[1-(4-nitrophenyl)ethylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2831900 |
| Molecular Formula | C25H20N6O5 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-[2-[2-[1-(4-nitrophenyl)ethylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | CC(=NNC(=O)C(NC(=O)c1ccccc1)c1n[nH]c(=O)c2ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H20N6O5/c1-15(16-11-13-18(14-12-16)31(35)36)27-30-25(34)22(26-23(32)17-7-3-2-4-8-17)21-19-9-5-6-10-20(19)24(33)29-28-21/h2-14,22H,1H3,(H,26,32)(H,29,33)(H,30,34) |
| InChIKey | LVIGJWRKTYQBJW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|