C24H25NO5 — CID 1294551
methyl 1-[(3S,4R)-2-oxo-3-(phenylcarbamoyl)-3,4-dihydrochromen-4-yl]cyclohexane-1-carboxylate (PubChem CID 1294551) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 1-[(3S,4R)-2-oxo-3-(phenylcarbamoyl)-3,4-dihydrochromen-4-yl]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(3S,4R)-2-oxo-3-(phenylcarbamoyl)-3,4-dihydrochromen-4-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 1294551 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl 1-[(3S,4R)-2-oxo-3-(phenylcarbamoyl)-3,4-dihydrochromen-4-yl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1([C@H]2c3ccccc3OC(=O)[C@@H]2C(=O)Nc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C24H25NO5/c1-29-23(28)24(14-8-3-9-15-24)20-17-12-6-7-13-18(17)30-22(27)19(20)21(26)25-16-10-4-2-5-11-16/h2,4-7,10-13,19-20H,3,8-9,14-15H2,1H3,(H,25,26)/t19-,20-/m0/s1 |
| InChIKey | WYGHTMZVIAXLRK-PMACEKPBSA-N |
| XLogP | 4.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|