C11H18N2 — CID 129463002
(3S,4R)-4-cyclohexylpyrrolidine-3-carbonitrile (PubChem CID 129463002) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (3S,4R)-4-cyclohexylpyrrolidine-3-carbonitrile.
| Compound Name | (3S,4R)-4-cyclohexylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 129463002 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (3S,4R)-4-cyclohexylpyrrolidine-3-carbonitrile |
| SMILES | N#C[C@@H]1CNC[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C11H18N2/c12-6-10-7-13-8-11(10)9-4-2-1-3-5-9/h9-11,13H,1-5,7-8H2/t10-,11-/m1/s1 |
| InChIKey | GFXQBHHTVHPABN-GHMZBOCLSA-N |
| XLogP | 1.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |