C21H39N — CID 54064226
3,4-di(cyclooctyl)piperidine (PubChem CID 54064226) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is 3,4-di(cyclooctyl)piperidine.
| Compound Name | 3,4-di(cyclooctyl)piperidine |
|---|---|
| PubChem CID | 54064226 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | 3,4-di(cyclooctyl)piperidine |
| SMILES | C1CCCC(C2CCNCC2C2CCCCCCC2)CCC1 |
| InChI | InChI=1S/C21H39N/c1-3-7-11-18(12-8-4-1)20-15-16-22-17-21(20)19-13-9-5-2-6-10-14-19/h18-22H,1-17H2 |
| InChIKey | HBGMACOJCFBOSY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |