C16H24N4O4 — CID 129471736
tert-butyl (3S)-1-[(4-methyl-3-oxopyrazin-2-yl)carbamoyl]piperidine-3-carboxylate (PubChem CID 129471736) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is tert-butyl (3S)-1-[(4-methyl-3-oxopyrazin-2-yl)carbamoyl]piperidine-3-carboxylate.
| Compound Name | tert-butyl (3S)-1-[(4-methyl-3-oxopyrazin-2-yl)carbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 129471736 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl (3S)-1-[(4-methyl-3-oxopyrazin-2-yl)carbamoyl]piperidine-3-carboxylate |
| SMILES | Cn1ccnc(NC(=O)N2CCC[C@H](C(=O)OC(C)(C)C)C2)c1=O |
| InChI | InChI=1S/C16H24N4O4/c1-16(2,3)24-14(22)11-6-5-8-20(10-11)15(23)18-12-13(21)19(4)9-7-17-12/h7,9,11H,5-6,8,10H2,1-4H3,(H,17,18,23)/t11-/m0/s1 |
| InChIKey | ZPGCQQTUXWDQES-NSHDSACASA-N |
| XLogP | 1.37 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |