C11H17F2NO — CID 129481915
(1R)-3,3-difluoro-N-(2-methylprop-2-enyl)cyclohexane-1-carboxamide (PubChem CID 129481915) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is (1R)-3,3-difluoro-N-(2-methylprop-2-enyl)cyclohexane-1-carboxamide.
| Compound Name | (1R)-3,3-difluoro-N-(2-methylprop-2-enyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 129481915 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (1R)-3,3-difluoro-N-(2-methylprop-2-enyl)cyclohexane-1-carboxamide |
| SMILES | C=C(C)CNC(=O)[C@@H]1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H17F2NO/c1-8(2)7-14-10(15)9-4-3-5-11(12,13)6-9/h9H,1,3-7H2,2H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | NOJYLLUFYZRTRI-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|