C14H14N4O2 — CID 129489687
2-(indazol-1-ylmethyl)-5-[(3R)-oxolan-3-yl]-1,3,4-oxadiazole (PubChem CID 129489687) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(indazol-1-ylmethyl)-5-[(3R)-oxolan-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(indazol-1-ylmethyl)-5-[(3R)-oxolan-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 129489687 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(indazol-1-ylmethyl)-5-[(3R)-oxolan-3-yl]-1,3,4-oxadiazole |
| SMILES | c1ccc2c(c1)cnn2Cc1nnc([C@@H]2CCOC2)o1 |
| InChI | InChI=1S/C14H14N4O2/c1-2-4-12-10(3-1)7-15-18(12)8-13-16-17-14(20-13)11-5-6-19-9-11/h1-4,7,11H,5-6,8-9H2/t11-/m1/s1 |
| InChIKey | TWFBOFZNSPJJTE-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |