C9H14N2 — CID 129493545
(3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindole-3a-carbonitrile (PubChem CID 129493545) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindole-3a-carbonitrile.
| Compound Name | (3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindole-3a-carbonitrile |
|---|---|
| PubChem CID | 129493545 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (3aS,7aS)-1,2,3,4,5,6,7,7a-octahydroisoindole-3a-carbonitrile |
| SMILES | N#C[C@@]12CCCC[C@@H]1CNC2 |
| InChI | InChI=1S/C9H14N2/c10-6-9-4-2-1-3-8(9)5-11-7-9/h8,11H,1-5,7H2/t8-,9-/m1/s1 |
| InChIKey | OYQGTNGDZMQNDU-RKDXNWHRSA-N |
| XLogP | 1.29 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |