C7H9NO2 — CID 129498556
(5S)-3-ethyl-5-ethynyl-1,3-oxazolidin-2-one (PubChem CID 129498556) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (5S)-3-ethyl-5-ethynyl-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-ethyl-5-ethynyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 129498556 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (5S)-3-ethyl-5-ethynyl-1,3-oxazolidin-2-one |
| SMILES | C#C[C@H]1CN(CC)C(=O)O1 |
| InChI | InChI=1S/C7H9NO2/c1-3-6-5-8(4-2)7(9)10-6/h1,6H,4-5H2,2H3/t6-/m0/s1 |
| InChIKey | FYVWJWVUIPUSDW-LURJTMIESA-N |
| XLogP | 0.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|