C7H7F7O3 — CID 12951200
5,5,6,6,7,7,7-heptafluoro-4,4-dihydroxyheptan-2-one (PubChem CID 12951200) has the molecular formula C7H7F7O3 and a molecular weight of 272.12 g/mol. Its IUPAC name is 5,5,6,6,7,7,7-heptafluoro-4,4-dihydroxyheptan-2-one.
| Compound Name | 5,5,6,6,7,7,7-heptafluoro-4,4-dihydroxyheptan-2-one |
|---|---|
| PubChem CID | 12951200 |
| Molecular Formula | C7H7F7O3 |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5,5,6,6,7,7,7-heptafluoro-4,4-dihydroxyheptan-2-one |
| SMILES | CC(=O)CC(O)(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F7O3/c1-3(15)2-4(16,17)5(8,9)6(10,11)7(12,13)14/h16-17H,2H2,1H3 |
| InChIKey | WYBMMPGHGBDGCA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|