C17H18ClFN2O4 — CID 12959725
3-[[2-[(4-chloro-2-fluorophenyl)carbamoyl]cyclohexene-1-carbonyl]amino]propanoic acid (PubChem CID 12959725) has the molecular formula C17H18ClFN2O4 and a molecular weight of 368.79 g/mol. Its IUPAC name is 3-[[2-[(4-chloro-2-fluorophenyl)carbamoyl]cyclohexene-1-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[2-[(4-chloro-2-fluorophenyl)carbamoyl]cyclohexene-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 12959725 |
| Molecular Formula | C17H18ClFN2O4 |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-[[2-[(4-chloro-2-fluorophenyl)carbamoyl]cyclohexene-1-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C1=C(C(=O)Nc2ccc(Cl)cc2F)CCCC1 |
| InChI | InChI=1S/C17H18ClFN2O4/c18-10-5-6-14(13(19)9-10)21-17(25)12-4-2-1-3-11(12)16(24)20-8-7-15(22)23/h5-6,9H,1-4,7-8H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | ZHWPFXWNLWFWER-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |