About 4-benzhydrylidene-2,3-dibromonaphthalen-1-one
4-benzhydrylidene-2,3-dibromonaphthalen-1-one (PubChem CID 12963079) has the molecular formula C23H14Br2O
and a molecular weight of 466.17 g/mol. Its IUPAC name is 4-benzhydrylidene-2,3-dibromonaphthalen-1-one.
Molecular Properties
| Compound Name | 4-benzhydrylidene-2,3-dibromonaphthalen-1-one |
| PubChem CID | 12963079 |
| Molecular Formula | C23H14Br2O |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | 4-benzhydrylidene-2,3-dibromonaphthalen-1-one |
| SMILES | O=C1C(Br)=C(Br)C(=C(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H14Br2O/c24-21-20(17-13-7-8-14-18(17)23(26)22(21)25)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H |
| InChIKey | YGZWVPHJZOTMGK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-benzhydrylidene-2,3-dibromonaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzhydrylidene-2,3-dibromonaphthalen-1-one?
The IUPAC name of 4-benzhydrylidene-2,3-dibromonaphthalen-1-one (CID 12963079) is 4-benzhydrylidene-2,3-dibromonaphthalen-1-one.
What is the SMILES notation for 4-benzhydrylidene-2,3-dibromonaphthalen-1-one?
The canonical SMILES for 4-benzhydrylidene-2,3-dibromonaphthalen-1-one is O=C1C(Br)=C(Br)C(=C(c2ccccc2)c2ccccc2)c2ccccc21.
What is the InChIKey of 4-benzhydrylidene-2,3-dibromonaphthalen-1-one?
The InChIKey is YGZWVPHJZOTMGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14Br2O/c24-21-20(17-13-7-8-14-18(17)23(26)22(21)25)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H.
What are the key properties of 4-benzhydrylidene-2,3-dibromonaphthalen-1-one?
4-benzhydrylidene-2,3-dibromonaphthalen-1-one has a molecular weight of 466.17 g/mol, XLogP of 6.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzhydrylidene-2,3-dibromonaphthalen-1-one is sourced from PubChem (CID 12963079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).