C17H10Br2O2 — CID 101079192
4-benzhydrylidene-2,2-dibromocyclobutane-1,3-dione (PubChem CID 101079192) has the molecular formula C17H10Br2O2 and a molecular weight of 406.07 g/mol. Its IUPAC name is 4-benzhydrylidene-2,2-dibromocyclobutane-1,3-dione.
| Compound Name | 4-benzhydrylidene-2,2-dibromocyclobutane-1,3-dione |
|---|---|
| PubChem CID | 101079192 |
| Molecular Formula | C17H10Br2O2 |
| Molecular Weight | 406.07 g/mol |
| Exact Mass | 403.90 |
| IUPAC Name | 4-benzhydrylidene-2,2-dibromocyclobutane-1,3-dione |
| SMILES | O=C1C(=C(c2ccccc2)c2ccccc2)C(=O)C1(Br)Br |
| InChI | InChI=1S/C17H10Br2O2/c18-17(19)15(20)14(16(17)21)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | QIVCGDNKPDZBKP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.07 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|