C16H21NO2S2 — CID 12965686
4-methyl-N-(3-methylsulfanylprop-2-ynyl)-N-[(Z)-pent-3-en-2-yl]benzenesulfonamide (PubChem CID 12965686) has the molecular formula C16H21NO2S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 4-methyl-N-(3-methylsulfanylprop-2-ynyl)-N-[(Z)-pent-3-en-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-(3-methylsulfanylprop-2-ynyl)-N-[(Z)-pent-3-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 12965686 |
| Molecular Formula | C16H21NO2S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-methyl-N-(3-methylsulfanylprop-2-ynyl)-N-[(Z)-pent-3-en-2-yl]benzenesulfonamide |
| SMILES | C/C=C\C(C)N(CC#CSC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO2S2/c1-5-7-15(3)17(12-6-13-20-4)21(18,19)16-10-8-14(2)9-11-16/h5,7-11,15H,12H2,1-4H3/b7-5- |
| InChIKey | ZPUQYVRRFCYWRK-ALCCZGGFSA-N |
| XLogP | 3.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|