C18H19NO2S2 — CID 135077237
N-but-2-ynyl-4-methyl-N-[(1S)-1-thiophen-2-ylprop-2-enyl]benzenesulfonamide (PubChem CID 135077237) has the molecular formula C18H19NO2S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-but-2-ynyl-4-methyl-N-[(1S)-1-thiophen-2-ylprop-2-enyl]benzenesulfonamide.
| Compound Name | N-but-2-ynyl-4-methyl-N-[(1S)-1-thiophen-2-ylprop-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135077237 |
| Molecular Formula | C18H19NO2S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-but-2-ynyl-4-methyl-N-[(1S)-1-thiophen-2-ylprop-2-enyl]benzenesulfonamide |
| SMILES | C=C[C@@H](c1cccs1)N(CC#CC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO2S2/c1-4-6-13-19(17(5-2)18-8-7-14-22-18)23(20,21)16-11-9-15(3)10-12-16/h5,7-12,14,17H,2,13H2,1,3H3/t17-/m0/s1 |
| InChIKey | UGAUKKKZOKCMDO-KRWDZBQOSA-N |
| XLogP | 4.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|