C29H29NO3 — CID 12965937
tert-butyl 1-benzhydryl-4-benzoyl-2,3-dihydropyrrole-2-carboxylate (PubChem CID 12965937) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl 1-benzhydryl-4-benzoyl-2,3-dihydropyrrole-2-carboxylate.
| Compound Name | tert-butyl 1-benzhydryl-4-benzoyl-2,3-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 12965937 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | tert-butyl 1-benzhydryl-4-benzoyl-2,3-dihydropyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(C(=O)c2ccccc2)=CN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29NO3/c1-29(2,3)33-28(32)25-19-24(27(31)23-17-11-6-12-18-23)20-30(25)26(21-13-7-4-8-14-21)22-15-9-5-10-16-22/h4-18,20,25-26H,19H2,1-3H3 |
| InChIKey | ROXIMIYRVIQQCA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |