C18H27NO6 — CID 12966476
1-O-tert-butyl 2-O-methyl (2S,5R)-5-[(Z)-1-ethoxy-1-oxopent-2-en-2-yl]-2,5-dihydropyrrole-1,2-dicarboxylate (PubChem CID 12966476) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,5R)-5-[(Z)-1-ethoxy-1-oxopent-2-en-2-yl]-2,5-dihydropyrrole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,5R)-5-[(Z)-1-ethoxy-1-oxopent-2-en-2-yl]-2,5-dihydropyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 12966476 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,5R)-5-[(Z)-1-ethoxy-1-oxopent-2-en-2-yl]-2,5-dihydropyrrole-1,2-dicarboxylate |
| SMILES | CC/C=C(\C(=O)OCC)[C@H]1C=C[C@@H](C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO6/c1-7-9-12(15(20)24-8-2)13-10-11-14(16(21)23-6)19(13)17(22)25-18(3,4)5/h9-11,13-14H,7-8H2,1-6H3/b12-9-/t13-,14+/m1/s1 |
| InChIKey | LLZRYJNKHBRYCR-CUSVYIHLSA-N |
| XLogP | 2.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|