C16H21NO6 — CID 138965272
triethyl (1R,4S,5S)-8-azabicyclo[3.2.1]octa-2,6-diene-2,4,8-tricarboxylate (PubChem CID 138965272) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is triethyl (1R,4S,5S)-8-azabicyclo[3.2.1]octa-2,6-diene-2,4,8-tricarboxylate.
| Compound Name | triethyl (1R,4S,5S)-8-azabicyclo[3.2.1]octa-2,6-diene-2,4,8-tricarboxylate |
|---|---|
| PubChem CID | 138965272 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | triethyl (1R,4S,5S)-8-azabicyclo[3.2.1]octa-2,6-diene-2,4,8-tricarboxylate |
| SMILES | CCOC(=O)C1=C[C@H](C(=O)OCC)[C@@H]2C=C[C@H]1N2C(=O)OCC |
| InChI | InChI=1S/C16H21NO6/c1-4-21-14(18)10-9-11(15(19)22-5-2)13-8-7-12(10)17(13)16(20)23-6-3/h7-10,12-13H,4-6H2,1-3H3/t10-,12-,13+/m0/s1 |
| InChIKey | ZVSNMSKBQTYPKP-WCFLWFBJSA-N |
| XLogP | 1.43 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|