C14H19NO4 — CID 15287131
8-O-tert-butyl 2-O-methyl (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate (PubChem CID 15287131) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 15287131 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
| SMILES | COC(=O)C1=CC[C@@H]2C=C[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19NO4/c1-14(2,3)19-13(17)15-9-5-7-10(12(16)18-4)11(15)8-6-9/h6-9,11H,5H2,1-4H3/t9-,11-/m1/s1 |
| InChIKey | MEWDBUDHJRSOHF-MWLCHTKSSA-N |
| XLogP | 2.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|