C24H46O5Si2 — CID 12966870
trans-methyl (1S,2S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-1-enyl]-6-oxocyclohexane-1-carboxylate (PubChem CID 12966870) has the molecular formula C24H46O5Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-1-enyl]-6-oxocyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-1-enyl]-6-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 12966870 |
| Molecular Formula | C24H46O5Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | trans-methyl (1S,2S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-1-enyl]-6-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)CCC[C@H]1C=C(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O5Si2/c1-23(2,3)30(8,9)28-16-18(17-29-31(10,11)24(4,5)6)15-19-13-12-14-20(25)21(19)22(26)27-7/h15,19,21H,12-14,16-17H2,1-11H3/t19-,21-/m0/s1 |
| InChIKey | WOJIIMNPDJGPEO-FPOVZHCZSA-N |
| XLogP | 6.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|