C26H42O6Si — CID 50941238
diethyl 7-acetyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4,6,7,8,9-hexahydrobenzo[7]annulene-3,3-dicarboxylate (PubChem CID 50941238) has the molecular formula C26H42O6Si and a molecular weight of 478.70 g/mol. Its IUPAC name is diethyl 7-acetyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4,6,7,8,9-hexahydrobenzo[7]annulene-3,3-dicarboxylate.
| Compound Name | diethyl 7-acetyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4,6,7,8,9-hexahydrobenzo[7]annulene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 50941238 |
| Molecular Formula | C26H42O6Si |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | diethyl 7-acetyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4,6,7,8,9-hexahydrobenzo[7]annulene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC=C2CCC(C(C)=O)CC(CO[Si](C)(C)C(C)(C)C)=C2C1 |
| InChI | InChI=1S/C26H42O6Si/c1-9-30-23(28)26(24(29)31-10-2)14-13-19-11-12-20(18(3)27)15-21(22(19)16-26)17-32-33(7,8)25(4,5)6/h13,20H,9-12,14-17H2,1-8H3 |
| InChIKey | ASDCSVNBZYHJCU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|