C22H40O5Si — CID 16720062
dimethyl 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-2-(cyclohexylmethyl)propanedioate (PubChem CID 16720062) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-2-(cyclohexylmethyl)propanedioate.
| Compound Name | dimethyl 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-2-(cyclohexylmethyl)propanedioate |
|---|---|
| PubChem CID | 16720062 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | dimethyl 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-2-(cyclohexylmethyl)propanedioate |
| SMILES | COC(=O)C(C/C=C/CO[Si](C)(C)C(C)(C)C)(CC1CCCCC1)C(=O)OC |
| InChI | InChI=1S/C22H40O5Si/c1-21(2,3)28(6,7)27-16-12-11-15-22(19(23)25-4,20(24)26-5)17-18-13-9-8-10-14-18/h11-12,18H,8-10,13-17H2,1-7H3/b12-11+ |
| InChIKey | SSYYGGSTSIWDPI-VAWYXSNFSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|