C23H21F12O2P — CID 12973329
2-[2-[1-butyl-1-methyl-3,3-bis(trifluoromethyl)-2,1lambda5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 12973329) has the molecular formula C23H21F12O2P and a molecular weight of 588.37 g/mol. Its IUPAC name is 2-[2-[1-butyl-1-methyl-3,3-bis(trifluoromethyl)-2,1lambda5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-[1-butyl-1-methyl-3,3-bis(trifluoromethyl)-2,1lambda5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 12973329 |
| Molecular Formula | C23H21F12O2P |
| Molecular Weight | 588.37 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | 2-[2-[1-butyl-1-methyl-3,3-bis(trifluoromethyl)-2,1lambda5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCCCP1(C)(c2ccccc2C(O)(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)(C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C23H21F12O2P/c1-3-4-13-38(2,16-11-7-5-9-14(16)18(36,20(24,25)26)21(27,28)29)17-12-8-6-10-15(17)19(37-38,22(30,31)32)23(33,34)35/h5-12,36H,3-4,13H2,1-2H3 |
| InChIKey | QYQAQVGWGKDLRY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.37 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|