C25H15F12O2P — CID 11093258
1-benzyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] (PubChem CID 11093258) has the molecular formula C25H15F12O2P and a molecular weight of 606.34 g/mol. Its IUPAC name is 1-benzyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole].
| Compound Name | 1-benzyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
|---|---|
| PubChem CID | 11093258 |
| Molecular Formula | C25H15F12O2P |
| Molecular Weight | 606.34 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | 1-benzyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
| SMILES | FC(F)(F)C1(C(F)(F)F)OP2(Cc3ccccc3)(OC(C(F)(F)F)(C(F)(F)F)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C25H15F12O2P/c26-22(27,28)20(23(29,30)31)16-10-4-6-12-18(16)40(38-20,14-15-8-2-1-3-9-15)19-13-7-5-11-17(19)21(39-40,24(32,33)34)25(35,36)37/h1-13H,14H2 |
| InChIKey | MMLWXLMLQWLDMB-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.34 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|