C27H19F12O2P — CID 101153200
3,3,3',3'-tetrakis(trifluoromethyl)-1-(2,4,6-trimethylphenyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] (PubChem CID 101153200) has the molecular formula C27H19F12O2P and a molecular weight of 634.40 g/mol. Its IUPAC name is 3,3,3',3'-tetrakis(trifluoromethyl)-1-(2,4,6-trimethylphenyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole].
| Compound Name | 3,3,3',3'-tetrakis(trifluoromethyl)-1-(2,4,6-trimethylphenyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
|---|---|
| PubChem CID | 101153200 |
| Molecular Formula | C27H19F12O2P |
| Molecular Weight | 634.40 g/mol |
| Exact Mass | 634.09 |
| IUPAC Name | 3,3,3',3'-tetrakis(trifluoromethyl)-1-(2,4,6-trimethylphenyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
| SMILES | Cc1cc(C)c(P23(OC(C(F)(F)F)(C(F)(F)F)c4ccccc42)OC(C(F)(F)F)(C(F)(F)F)c2ccccc23)c(C)c1 |
| InChI | InChI=1S/C27H19F12O2P/c1-14-12-15(2)21(16(3)13-14)42(19-10-6-4-8-17(19)22(40-42,24(28,29)30)25(31,32)33)20-11-7-5-9-18(20)23(41-42,26(34,35)36)27(37,38)39/h4-13H,1-3H3 |
| InChIKey | HPSUJIRGGCGFDQ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.40 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|