C32H19F12O3P — CID 101214525
1-[(E)-1,2-diphenylethenoxy]-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] (PubChem CID 101214525) has the molecular formula C32H19F12O3P and a molecular weight of 710.45 g/mol. Its IUPAC name is 1-[(E)-1,2-diphenylethenoxy]-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole].
| Compound Name | 1-[(E)-1,2-diphenylethenoxy]-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
|---|---|
| PubChem CID | 101214525 |
| Molecular Formula | C32H19F12O3P |
| Molecular Weight | 710.45 g/mol |
| Exact Mass | 710.09 |
| IUPAC Name | 1-[(E)-1,2-diphenylethenoxy]-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
| SMILES | FC(F)(F)C1(C(F)(F)F)OP2(O/C(=C/c3ccccc3)c3ccccc3)(OC(C(F)(F)F)(C(F)(F)F)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C32H19F12O3P/c33-29(34,35)27(30(36,37)38)22-15-7-9-17-25(22)48(46-27,45-24(21-13-5-2-6-14-21)19-20-11-3-1-4-12-20)26-18-10-8-16-23(26)28(47-48,31(39,40)41)32(42,43)44/h1-19H/b24-19+ |
| InChIKey | WDIYJVLYIJOGRL-LYBHJNIJSA-N |
| XLogP | 9.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.45 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|