C33H31F12O2P — CID 11399883
3,3,3',3'-tetrakis(trifluoromethyl)-1-[2,4,6-tri(propan-2-yl)phenyl]-1,1'-spirobi[2,1λ5-benzoxaphosphole] (PubChem CID 11399883) has the molecular formula C33H31F12O2P and a molecular weight of 718.56 g/mol. Its IUPAC name is 3,3,3',3'-tetrakis(trifluoromethyl)-1-[2,4,6-tri(propan-2-yl)phenyl]-1,1'-spirobi[2,1λ5-benzoxaphosphole].
| Compound Name | 3,3,3',3'-tetrakis(trifluoromethyl)-1-[2,4,6-tri(propan-2-yl)phenyl]-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
|---|---|
| PubChem CID | 11399883 |
| Molecular Formula | C33H31F12O2P |
| Molecular Weight | 718.56 g/mol |
| Exact Mass | 718.19 |
| IUPAC Name | 3,3,3',3'-tetrakis(trifluoromethyl)-1-[2,4,6-tri(propan-2-yl)phenyl]-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
| SMILES | CC(C)c1cc(C(C)C)c(P23(OC(C(F)(F)F)(C(F)(F)F)c4ccccc42)OC(C(F)(F)F)(C(F)(F)F)c2ccccc23)c(C(C)C)c1 |
| InChI | InChI=1S/C33H31F12O2P/c1-17(2)20-15-21(18(3)4)27(22(16-20)19(5)6)48(25-13-9-7-11-23(25)28(46-48,30(34,35)36)31(37,38)39)26-14-10-8-12-24(26)29(47-48,32(40,41)42)33(43,44)45/h7-19H,1-6H3 |
| InChIKey | PMIKFSFDTWSGFV-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.56 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|