C22H17F12O2P — CID 11753431
1-butyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] (PubChem CID 11753431) has the molecular formula C22H17F12O2P and a molecular weight of 572.33 g/mol. Its IUPAC name is 1-butyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole].
| Compound Name | 1-butyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
|---|---|
| PubChem CID | 11753431 |
| Molecular Formula | C22H17F12O2P |
| Molecular Weight | 572.33 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 1-butyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1λ5-benzoxaphosphole] |
| SMILES | CCCCP12(OC(C(F)(F)F)(C(F)(F)F)c3ccccc31)OC(C(F)(F)F)(C(F)(F)F)c1ccccc12 |
| InChI | InChI=1S/C22H17F12O2P/c1-2-3-12-37(15-10-6-4-8-13(15)17(35-37,19(23,24)25)20(26,27)28)16-11-7-5-9-14(16)18(36-37,21(29,30)31)22(32,33)34/h4-11H,2-3,12H2,1H3 |
| InChIKey | HKTLODXGGNHOGC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.33 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|