C30H25F6OSb — CID 16703557
1,1,1-tris(4-methylphenyl)-3,3-bis(trifluoromethyl)-2,1λ5-benzoxastibole (PubChem CID 16703557) has the molecular formula C30H25F6OSb and a molecular weight of 637.28 g/mol. Its IUPAC name is 1,1,1-tris(4-methylphenyl)-3,3-bis(trifluoromethyl)-2,1λ5-benzoxastibole.
| Compound Name | 1,1,1-tris(4-methylphenyl)-3,3-bis(trifluoromethyl)-2,1λ5-benzoxastibole |
|---|---|
| PubChem CID | 16703557 |
| Molecular Formula | C30H25F6OSb |
| Molecular Weight | 637.28 g/mol |
| Exact Mass | 636.08 |
| IUPAC Name | 1,1,1-tris(4-methylphenyl)-3,3-bis(trifluoromethyl)-2,1λ5-benzoxastibole |
| SMILES | Cc1ccc([Sb]2(c3ccc(C)cc3)(c3ccc(C)cc3)OC(C(F)(F)F)(C(F)(F)F)c3ccccc32)cc1 |
| InChI | InChI=1S/C9H4F6O.3C7H7.Sb/c10-8(11,12)7(16,9(13,14)15)6-4-2-1-3-5-6;3*1-7-5-3-2-4-6-7;/h1-4H;3*3-6H,1H3;/q-1;;;;+1 |
| InChIKey | XOHRMFFDWZRRBE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.28 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|