C26H19F12O2P — CID 12973330
2-[2-[1-benzyl-1-methyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 12973330) has the molecular formula C26H19F12O2P and a molecular weight of 622.39 g/mol. Its IUPAC name is 2-[2-[1-benzyl-1-methyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-[1-benzyl-1-methyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 12973330 |
| Molecular Formula | C26H19F12O2P |
| Molecular Weight | 622.39 g/mol |
| Exact Mass | 622.09 |
| IUPAC Name | 2-[2-[1-benzyl-1-methyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CP1(Cc2ccccc2)(c2ccccc2C(O)(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)(C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C26H19F12O2P/c1-41(15-16-9-3-2-4-10-16,19-13-7-5-11-17(19)21(39,23(27,28)29)24(30,31)32)20-14-8-6-12-18(20)22(40-41,25(33,34)35)26(36,37)38/h2-14,39H,15H2,1H3 |
| InChIKey | GDHFUKVFXHXQPN-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.39 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|