C25H17F12O2P — CID 12973331
1,1,1,3,3,3-hexafluoro-2-[2-[1-methyl-1-phenyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]propan-2-ol (PubChem CID 12973331) has the molecular formula C25H17F12O2P and a molecular weight of 608.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-[1-methyl-1-phenyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-[1-methyl-1-phenyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 12973331 |
| Molecular Formula | C25H17F12O2P |
| Molecular Weight | 608.36 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-[1-methyl-1-phenyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]propan-2-ol |
| SMILES | CP1(c2ccccc2)(c2ccccc2C(O)(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)(C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C25H17F12O2P/c1-40(15-9-3-2-4-10-15,18-13-7-5-11-16(18)20(38,22(26,27)28)23(29,30)31)19-14-8-6-12-17(19)21(39-40,24(32,33)34)25(35,36)37/h2-14,38H,1H3 |
| InChIKey | WRUTXLRQJGCWDF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.36 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|