C14H30Si3 — CID 12980106
[2,4-bis(trimethylsilyl)cyclopenta-2,4-dien-1-yl]-trimethylsilane (PubChem CID 12980106) has the molecular formula C14H30Si3 and a molecular weight of 282.65 g/mol. Its IUPAC name is [2,4-bis(trimethylsilyl)cyclopenta-2,4-dien-1-yl]-trimethylsilane.
| Compound Name | [2,4-bis(trimethylsilyl)cyclopenta-2,4-dien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 12980106 |
| Molecular Formula | C14H30Si3 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [2,4-bis(trimethylsilyl)cyclopenta-2,4-dien-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=CC([Si](C)(C)C)C([Si](C)(C)C)=C1 |
| InChI | InChI=1S/C14H30Si3/c1-15(2,3)12-10-13(16(4,5)6)14(11-12)17(7,8)9/h10-11,13H,1-9H3 |
| InChIKey | BEQTXYOHRBLJDZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|