C17H16ClNO2 — CID 12982844
(3R,4S)-2-benzyl-3-(4-chlorophenyl)-1,2-oxazolidine-4-carbaldehyde (PubChem CID 12982844) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is (3R,4S)-2-benzyl-3-(4-chlorophenyl)-1,2-oxazolidine-4-carbaldehyde.
| Compound Name | (3R,4S)-2-benzyl-3-(4-chlorophenyl)-1,2-oxazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 12982844 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (3R,4S)-2-benzyl-3-(4-chlorophenyl)-1,2-oxazolidine-4-carbaldehyde |
| SMILES | O=C[C@@H]1CON(Cc2ccccc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO2/c18-16-8-6-14(7-9-16)17-15(11-20)12-21-19(17)10-13-4-2-1-3-5-13/h1-9,11,15,17H,10,12H2/t15-,17+/m1/s1 |
| InChIKey | VYQOQNZKJLJZGP-WBVHZDCISA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|