C18H13F3N4S — CID 12985734
4-[(2-sulfanylidene-1H-imidazol-3-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile (PubChem CID 12985734) has the molecular formula C18H13F3N4S and a molecular weight of 374.39 g/mol. Its IUPAC name is 4-[(2-sulfanylidene-1H-imidazol-3-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile.
| Compound Name | 4-[(2-sulfanylidene-1H-imidazol-3-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 12985734 |
| Molecular Formula | C18H13F3N4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 4-[(2-sulfanylidene-1H-imidazol-3-yl)-[[4-(trifluoromethyl)phenyl]methyl]amino]benzonitrile |
| SMILES | N#Cc1ccc(N(Cc2ccc(C(F)(F)F)cc2)n2cc[nH]c2=S)cc1 |
| InChI | InChI=1S/C18H13F3N4S/c19-18(20,21)15-5-1-14(2-6-15)12-25(24-10-9-23-17(24)26)16-7-3-13(11-22)4-8-16/h1-10H,12H2,(H,23,26) |
| InChIKey | REGFTPMPHIQNLB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|