About N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide
N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 12987498) has the molecular formula C15H14ClNO4
and a molecular weight of 307.73 g/mol. Its IUPAC name is N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide |
| PubChem CID | 12987498 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCN(C(C)=O)C1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14ClNO4/c1-9(18)17(7-8-21-2)13-12(16)14(19)10-5-3-4-6-11(10)15(13)20/h3-6H,7-8H2,1-2H3 |
| InChIKey | QZUINWYTHMCTQK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide?
The IUPAC name of N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide (CID 12987498) is N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide?
The canonical SMILES for N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide is COCCN(C(C)=O)C1=C(Cl)C(=O)c2ccccc2C1=O.
What is the InChIKey of N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide?
The InChIKey is QZUINWYTHMCTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO4/c1-9(18)17(7-8-21-2)13-12(16)14(19)10-5-3-4-6-11(10)15(13)20/h3-6H,7-8H2,1-2H3.
What are the key properties of N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide?
N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide has a molecular weight of 307.73 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 12987498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).