C14H21BO8 — CID 12990363
diethyl (4R,5R)-2-[(E)-2-methoxycarbonylbut-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 12990363) has the molecular formula C14H21BO8 and a molecular weight of 328.13 g/mol. Its IUPAC name is diethyl (4R,5R)-2-[(E)-2-methoxycarbonylbut-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-2-[(E)-2-methoxycarbonylbut-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 12990363 |
| Molecular Formula | C14H21BO8 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | diethyl (4R,5R)-2-[(E)-2-methoxycarbonylbut-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | C/C=C(\CB1O[C@@H](C(=O)OCC)[C@H](C(=O)OCC)O1)C(=O)OC |
| InChI | InChI=1S/C14H21BO8/c1-5-9(12(16)19-4)8-15-22-10(13(17)20-6-2)11(23-15)14(18)21-7-3/h5,10-11H,6-8H2,1-4H3/b9-5+/t10-,11-/m1/s1 |
| InChIKey | PHMAJCWHEOIJBG-UJQHZETGSA-N |
| XLogP | 0.50 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|