C22H31O16P — CID 23257343
tetraethyl 5-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,3,7,8-tetracarboxylate (PubChem CID 23257343) has the molecular formula C22H31O16P and a molecular weight of 582.45 g/mol. Its IUPAC name is tetraethyl 5-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,3,7,8-tetracarboxylate.
| Compound Name | tetraethyl 5-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,3,7,8-tetracarboxylate |
|---|---|
| PubChem CID | 23257343 |
| Molecular Formula | C22H31O16P |
| Molecular Weight | 582.45 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | tetraethyl 5-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,3,7,8-tetracarboxylate |
| SMILES | CCOC(=O)C1OP2(/C(=C\C(=O)OC)C(=O)OC)(OC1C(=O)OCC)OC(C(=O)OCC)C(C(=O)OCC)O2 |
| InChI | InChI=1S/C22H31O16P/c1-7-31-19(25)14-15(20(26)32-8-2)36-39(35-14,12(18(24)30-6)11-13(23)29-5)37-16(21(27)33-9-3)17(38-39)22(28)34-10-4/h11,14-17H,7-10H2,1-6H3/b12-11- |
| InChIKey | AYZRPTWTGPOKCD-QXMHVHEDSA-N |
| XLogP | 0.25 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.45 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|