C26H19O6P — CID 101434445
dimethyl (Z)-2-(3,3'-spirobi[2-oxa-3λ5-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-3-yl)but-2-enedioate (PubChem CID 101434445) has the molecular formula C26H19O6P and a molecular weight of 458.41 g/mol. Its IUPAC name is dimethyl (Z)-2-(3,3'-spirobi[2-oxa-3λ5-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-3-yl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-(3,3'-spirobi[2-oxa-3λ5-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-3-yl)but-2-enedioate |
|---|---|
| PubChem CID | 101434445 |
| Molecular Formula | C26H19O6P |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | dimethyl (Z)-2-(3,3'-spirobi[2-oxa-3λ5-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-3-yl)but-2-enedioate |
| SMILES | COC(=O)/C=C(/C(=O)OC)P12(Oc3cccc4cccc1c34)Oc1cccc3cccc2c13 |
| InChI | InChI=1S/C26H19O6P/c1-29-23(27)15-22(26(28)30-2)33(20-13-5-9-16-7-3-11-18(31-33)24(16)20)21-14-6-10-17-8-4-12-19(32-33)25(17)21/h3-15H,1-2H3/b22-15- |
| InChIKey | OEVSNGYMTHWZFS-JCMHNJIXSA-N |
| XLogP | 4.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|