C17H15NO8 — CID 17368169
trimethyl (Z,3Z)-3-(2-oxo-4H-1,4-benzoxazin-3-ylidene)prop-1-ene-1,2,3-tricarboxylate (PubChem CID 17368169) has the molecular formula C17H15NO8 and a molecular weight of 361.31 g/mol. Its IUPAC name is trimethyl (Z,3Z)-3-(2-oxo-4H-1,4-benzoxazin-3-ylidene)prop-1-ene-1,2,3-tricarboxylate.
| Compound Name | trimethyl (Z,3Z)-3-(2-oxo-4H-1,4-benzoxazin-3-ylidene)prop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 17368169 |
| Molecular Formula | C17H15NO8 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | trimethyl (Z,3Z)-3-(2-oxo-4H-1,4-benzoxazin-3-ylidene)prop-1-ene-1,2,3-tricarboxylate |
| SMILES | COC(=O)/C=C(C(=O)OC)/C(C(=O)OC)=C1/Nc2ccccc2OC1=O |
| InChI | InChI=1S/C17H15NO8/c1-23-12(19)8-9(15(20)24-2)13(16(21)25-3)14-17(22)26-11-7-5-4-6-10(11)18-14/h4-8,18H,1-3H3/b9-8-,14-13- |
| InChIKey | DVNLDWSFPOVJCO-ZQQYBVFVSA-N |
| XLogP | 0.72 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|